| Synonyms |
Imiquimod-d9; 1-(2-(methyl-d3)propyl-1,1,2,3,3,3-d6)-1H-imidazo[4,5-c]quinolin-4-amine; 4-amino-1-isobutyl-1h-imidazo[4,5-c]quinoline-d9 |
| IUPAC Name |
1-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]imidazo[4,5-c]quinolin-4-amine |
| Molecular Weight |
249.36 |
| Molecular Formula |
C14H7N4D9 |
| Canonical SMILES |
CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| InChI |
InChI=1S/C14H16N4/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9H,7H2,1-2H3,(H2,15,17)/i1D3,2D3,7D2,9D |
| InChIKey |
DOUYETYNHWVLEO-UEZIPFSLSA-N |
| Melting Point |
292-294°C |
| Purity |
> 95% |
| Solubility |
In vitro:
10 mM in DMSO |
| Appearance |
White to off-white solid |
| Storage |
2-8 °C |
| Complexity |
294 |
| Exact Mass |
249.193987241 |
| In Vitro |
Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and Metabolic profiles of drugs. |
| In Vivo |
In animal models, imiquimod stimulates the innate immune response by increasing NK cell activity, activating macrophages to secretecytokines and nitric oxide, and inducing proliferation and differentiation of B lymphocytes. Imiquimod stimulates the innate immune response through induction, synthesis, and release of cytokines, including interferon-a (IFN-α), interleukin (IL)-6, and tumour necrosis factor (TNF)-α. |
| Target |
Toll-like Receptor (TLR); Autophagy; SARS-CoV; HSV |
| XLogP3-AA |
2.6 |
![{PARAM:[Name]}({[CAS]})](https://resource.bocsci.com/structure/imiquimod-%5Bd9%5D.gif)