| Synonyms |
PSI-7409; PSI 7409; PSI7409; Uridine 5'-(tetrahydrogen triphosphate), 2'-deoxy-2'-fluoro-2'-methyl-, (2'R)-; (2'R)-2'-Deoxy-2'-fluoro-2'-methyluridine 5'-(tetrahydrogen triphosphate); GS 461203; Sofosbuvir triphosphate; Sofosbuvir-TP; Sofosbuvir-triphosphate; 2'-F-2'-C-Me-dUTP; 2'-Deoxy-2'-fluoro-2'-C-methyluridine 5'-triphosphate |
| IUPAC Name |
[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| Molecular Weight |
500.16 |
| Molecular Formula |
C10H16FN2O14P3 |
| Canonical SMILES |
CC1(C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)F |
| InChI |
InChI=1S/C10H16FN2O14P3/c1-10(11)7(15)5(25-8(10)13-3-2-6(14)12-9(13)16)4-24-29(20,21)27-30(22,23)26-28(17,18)19/h2-3,5,7-8,15H,4H2,1H3,(H,20,21)(H,22,23)(H,12,14,16)(H2,17,18,19)/t5-,7-,8-,10-/m1/s1 |
| InChIKey |
IPHULAIUXUVCHH-VPCXQMTMSA-N |
| Purity |
>95% |
| Density |
1.97±0.1 g/cm3 |
| Solubility |
Soluble in DMSO |
| Appearance |
White to off-white solid |
| Storage |
Store at -20 °C |
| Complexity |
891 |
| Exact Mass |
499.97984234 |
| Index Of Refraction |
1.601 |
| In Vitro |
PSI-7409 inhibits the enzymatic activities of these NS5BΔ21 polymerases in a dose-dependent manner. The IC50s for PSI- 7409 against GT 1b, 2a, 3a, and 4a NS5B polymerases are 1.6 μM, 2.8 μM, 0.7 μM, and 2.6 μM, respectively. PSI-7409 is a weak inhibitor of DNA Pol α (IC50=550 μM). DNA Pol β and γ are not inhibited by 1 mM PSI-7409. A significant amount of RNA product is made in the presence of 500 μM PSI-7409, about 85%. In clone A cells, the levels of PSI-7409 gradually increases to a maximum concentration of about 25 μm over a period of 48 h. PSI-7409 forms at a much faster rate in primary human hepatocytes, achieving a maximum intracellular concentration of -100 μM at 4 h and remains at that concentration for 48 . |
| PSA |
273.57000 |
| Target |
HCV |
| XLogP3-AA |
-4.9 |
![{PARAM:[Name]}({[CAS]})](https://resource.bocsci.com/structure/1015073-42-3.gif)