| Synonyms |
N'-(b-D-Ribofuranosyl)-5-hydroxyimidazole-4-carboxamide; Bredinin; 1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-hydroxy-1H-imidazole-4-carboxamide; 5-Hydroxy-1-beta-D-ribofuranosyl-1H-imidazole-4-carboxamide |
| IUPAC Name |
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxyimidazole-4-carboxamide |
| Molecular Weight |
259.22 |
| Molecular Formula |
C9H13N3O6 |
| Canonical SMILES |
C1=NC(=C(N1C2C(C(C(O2)CO)O)O)O)C(=O)N |
| InChI |
InChI=1S/C9H13N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,9,13-15,17H,1H2,(H2,10,16)/t3-,5-,6-,9-/m1/s |
| InChIKey |
HZQDCMWJEBCWBR-UUOKFMHZSA-N |
| Boiling Point |
755.9°C at 760 mmHg |
| Melting Point |
>200°C(dec.) |
| Flash Point |
410.9±32.9 °C |
| Purity |
≥95% |
| Density |
2.06 g/cm3 |
| Solubility |
Soluble in Water, Methanol, Ethanol |
| Appearance |
White Crystal |
| Application |
Anti-Inflammatory Agents, Non-Steroidal |
| Storage |
Store at -20°C |
| Complexity |
329 |
| Exact Mass |
259.08043514 |
| Index Of Refraction |
1.795 |
| In Vitro |
Mizoribine (1-50 mg/ml) was able to dose-dependently inhibit 10-100% of T cell proliferation with all tested contributing factors. Mizoribine leads to a decrease in intracellular GTP levels, the filling of GTP will reverse its anti-malignant proliferative effect. Mizoribine dose-dependently inhibits T cell proliferation, which is reversible upon addition of 50 mM guanosine to a guanine-filled nucleotide pool. Mizoribine selectively inhibits guanine nucleotide formation in pure T cells, while the action of 6-mercaptopurine (6MP) appears to be more dependent on adenine nucleotide consumption. Mizoribine inhibits HCV RNA replication with an IC50 value of 100 μM. |
| In Vivo |
Mizoribine (5 or 10 mg/kg) inhibits urinary albumin excretion in rats. In rat kidneys, Mizoribine (5 or 10 mg / kg) inhibits the development of glomerulosclerosis, renal interstitial fibrosis and macrophage infiltration. Mizoribine (5 or 10 mg/kg) increases the expression of MCP-1, OPN, and TGF-β1 mRNA in untreated OLETF rats. |
| PSA |
151.06000 |
| Target |
HCV; SARS-CoV |
| Vapor Pressure |
0.0±2.7 mmHg at 25°C |
| XLogP3-AA |
-1.9 |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/50924-49-7.gif)
