| Synonyms |
Laninamivir-d3; 5-(Acetylamino)-4-[(aminoiminomethyl)amino]-2,6-anhydro-3,4,5-trideoxy-7-O-methyl-D-glycero-D-galacto-Non-2-enonic Acid-d3; (4S,5R,6R)-5-Acetamido-4-guanidino-6-((1R,2R)-2,3-dihydroxy-1-methoxypropyl)-5,6-dihydro-4H-pyran-2-carboxylic Acid-d3 |
| IUPAC Name |
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-2,3-dihydroxy-1-(trideuteriomethoxy)propyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| Molecular Weight |
349.35 |
| Molecular Formula |
C13H19D3N4O7 |
| Canonical SMILES |
CC(=O)NC1C(C=C(OC1C(C(CO)O)OC)C(=O)O)N=C(N)N |
| InChI |
InChI=1S/C13H22N4O7/c1-5(19)16-9-6(17-13(14)15)3-8(12(21)22)24-11(9)10(23-2)7(20)4-18/h3,6-7,9-11,18,20H,4H2,1-2H3,(H,16,19)(H,21,22)(H4,14,15,17)/t6-,7+,9+,10+,11+/m0/s1/i2D3 |
| InChIKey |
QNRRHYPPQFELSF-UJUDIKNOSA-N |
| Purity |
≥98% (HPLC) |
| Solubility |
Soluble in Water (Slightly) |
| Appearance |
White Solid |
| Storage |
Store at -20°C |
| Complexity |
532 |
| Exact Mass |
349.16767929 |
| In Vitro |
Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and Metabolic profiles of drugs. |
| Target |
Influenza Virus |
| XLogP3-AA |
-3.2 |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/1286920-52-2.gif)
