| Synonyms |
(1S)-1,5-anhydro-1-(1,3,6,7-tetrahydroxy-9-oxo-9H-xanthen-4-yl)-D-glucitol;(1S)-1,5-Anhydro-1-(1,3,6,7-tetrahydroxy-9-oxo-9H-xanthen-4-yl)-D-glucitol; 9H-Xanthen-9-one, 4-beta-D-glucopyranosyl-1,3,6,7-tetrahydroxy-; D-glucitol, 1,5-anhydro-1-C-(1,3,6,7-te |
| IUPAC Name |
1,3,6,7-tetrahydroxy-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one |
| Molecular Weight |
422.34 |
| Molecular Formula |
C19H18O11 |
| Canonical SMILES |
C1=C2C(=CC(=C1O)O)OC3=C(C2=O)C(=CC(=C3C4C(C(C(C(O4)CO)O)O)O)O)O |
| InChI |
1S/C19H18O11/c20-4-11-15(26)16(27)17(28)19(30-11)13-9(24)2-8(23)12-14(25)5-1-6(21)7(22)3-10(5)29-18(12)13/h1-3,11,15-17,19-24,26-28H,4H2/t11-,15-,16+,17-,19+/m1/s1 |
| InChIKey |
CDYBOKJASDEORM-HBVDJMOISA-N |
| Boiling Point |
798.8±60.0 °C | Condition: Press: 760 Torr |
| Flash Point |
288.2±26.4 °C |
| Purity |
>98% |
| Density |
1.843±0.06 g/cm3 |
| Solubility |
Soluble in DMSO |
| Appearance |
Solid powder |
| Shelf Life |
2 years |
| Storage |
Store in a cool and dry place and at 0 - 4°C for short term (days to weeks) or -119°C for long term (months to years). |
| Complexity |
400 |
| Exact Mass |
288.06338810 |
| Index Of Refraction |
1.789 |
| In Vitro |
Isookanin exhibits excellent DPPH scavenging activities with the EC50 of 10.6 µM.
Isookanin shows comparable cellular antioxidant activity with the IC50 of 14.4 µM. |
| PSA |
201.28000 |
| Target |
HSV |
| Vapor Pressure |
0.0±3.0 mmHg at 25°C |
| XLogP3-AA |
1.5 |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/24699-16-9.gif)
