| Synonyms |
ORI-9020 ammonium; SB-9000 ammonium; O-{[(2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxytetrahydro-2-furanyl]methyl} O-[(2R,3R,4R,5R)-5-(2,4-dioxo-3,4-dihydro-1(2H)-pyrimidinyl)-2-(hydroxymethyl)-4-methoxytetrahydro-3-furanyl] hydrogen phosphorothioate ammoniate (1:1); O2'-methyl-P-thio-uridylyl-(3'->5')-2'-deoxy-adenosine ammonium |
| IUPAC Name |
1-[(2R,3R,4R,5R)-4-[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione;azane |
| Molecular Weight |
604.53 |
| Molecular Formula |
C20H29N8O10PS |
| Canonical SMILES |
COC1C(C(OC1N2C=CC(=O)NC2=O)CO)OP(=S)(O)OCC3C(CC(O3)N4C=NC5=C(N=CN=C54)N)O.N |
| InChI |
InChI=1S/C20H26N7O10PS.H3N/c1-33-16-15(10(5-28)36-19(16)26-3-2-12(30)25-20(26)31)37-38(32,39)34-6-11-9(29)4-13(35-11)27-8-24-14-17(21)22-7-23-18(14)27;/h2-3,7-11,13,15-16,19,28-29H,4-6H2,1H3,(H,32,39)(H2,21,22,23)(H,25,30,31);1H3/t9-,10+,11+,13+,15+,16+,19+,38?;/m0./s1 |
| InChIKey |
CAUBLFJDYDLFRY-NJCNYLKWSA-N |
| Purity |
≥95% |
| Solubility |
Soluble in DMSO, Water |
| Appearance |
White to light yellow (Solid) |
| Storage |
Store at 2-8°C, sealed storage, away from moisture |
| In Vitro |
Inarigivir (SB 9200) is active against HBV variants carrying resistance markers against all the nucleos(t)ide analogues approved for treating chronic hepatitis B. |
| In Vivo |
Inarigivir (100 mg/kg/day, ip) significantly reduces viral DNA in the liver and shows anti-HBV activity. Serum HBV DNA is not reduced in response to treatment. Inarigivir does not affect levels of HBV RNA in liver, levels of HBeAg in serum, or mean titers of HBsAg. The minimal effective dose is identified to be between 1.6 and 0.5 mg/kg/day using liver HBV DNA values. |
| Target |
HBV |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/2172788-92-8.gif)
