| Synonyms |
Cycloheptaamylose; Adrabetadex; BCD; Betadex; BW 7 (polysaccharide); Cavamax W 7; Celdex N; Cibatex OC-CLD; Cyclodextrin Beta W 7M1.8; Cycloheptaglucan; Cycloheptaglucosan; Cyclomaltoheptaose; CYL 3190; Dexipar β-100; Dextrin, β-cyclo; Dexy Pearl 100; HP-β-CD; HRBS-Q 009; Kleptose; Kleptose B; Kleptose STD; NSC 269471; NSC 314334; Rhodocap N; Rindex B; Ringdex B; Ringdex BL; Schardinger β-dextrin; Stereoisomer of 5,10,15,20,25,30,35-heptakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane-36,37,38,39,40,41,42,43,44,45,46,47,48,49-tetradecol; Trappsol Cyclo; VAR 200; VTS 270; β-Cycloamylose; β-Cycloheptaamylose; β-Dextrin |
| IUPAC Name |
(1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31S,33R,35R,36R,37R,38R,39R,40R,41R,42R,43R,44R,45R,46R,47R,48R)-5,10,15,20,25,30,35-heptakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane-36,37,38,39,40,41,42,43,44,45,46,47,48,49-tetradecol |
| Molecular Weight |
1134.98 |
| Molecular Formula |
C42H70O35 |
| Canonical SMILES |
C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(O2)C(C8O)O)CO)CO)CO)CO)CO)CO)O)O)O |
| InChI |
InChI=1S/C42H70O35/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51/h8-63H,1-7H2/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28?,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-/m1/s1 |
| InChIKey |
WHGYBXFWUBPSRW-DCPOFQRKSA-N |
| Boiling Point |
1541.2±60.0°C at 760 mmHg |
| Melting Point |
293-294°C (dec.) |
| Flash Point |
908.5°C |
| Purity |
≥95% |
| Density |
1.624±0.06 g/cm3 |
| Solubility |
Soluble in DMSO (Slightly), Water (Sparingly, Heated, Sonicated) |
| Appearance |
White Solid |
| Application |
Sequestering Agents |
| Storage |
Store at RT |
| Complexity |
1480 |
| Exact Mass |
1134.3697639 |
| Index Of Refraction |
1.591 |
| In Vitro |
β-Cyclodextrin (Beta-cyclodextrin; β-CD) is a cyclic polysaccharide composed of seven units of glucose (α-D-glucopyranose) linked by α-(1,4) type bonds, which presents a hydrophilic external surface and a hydrophobic internal cavity. In the pharmaceutical industry, β-Cyclodextrin (β-CD) has often been used to enhance the solubility of drugs, such as indomethacin, naringin, celecoxib, and citric acid. |
| PSA |
554.05000 |
| Target |
HIV |
| Vapor Pressure |
0.0±0.6 mmHg at 25°C |
![{PARAM:[Name]}({[CAS]})](https://resource.bocsci.com/structure/7585-39-9.gif)