| Synonyms |
(13s-e)-thyl; 2,3,9,10-tetramethoxy-13-alpha-methyl-13a-beta-berbin; 2,3,9,10-tetramethoxy-13-methyl-berbin; 6h-dibenzo(a,g)quinolizine,5,8,13,13a-tetrahydro-2,3,9,10-tetramethoxy-13-me; corydalin; (+) CORYDALINE; CORYDALINE; CORYDALINE, (+) |
| IUPAC Name |
(13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Molecular Weight |
369.44 |
| Molecular Formula |
C22H27NO4 |
| Canonical SMILES |
CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| InChI |
1S/C22H27NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-11,13,21H,8-9,12H2,1-5H3/t13-,21+/m0/s1 |
| InChIKey |
VRSRXLJTYQVOHC-YEJXKQKISA-N |
| Boiling Point |
482.3±45.0 °C at 760 mmHg |
| Melting Point |
135° |
| Flash Point |
135.7±25.9 °C |
| Purity |
>98% |
| Density |
1.2±0.1 g/cm3 |
| Solubility |
Soluble in DMSO |
| Appearance |
Cryst. |
| Application |
antiacetylcholinesterase, antiallergic, antinociceptive, |
| Shelf Life |
As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
| Storage |
Store at -20 °C |
| Complexity |
503 |
| Exact Mass |
369.19400834 |
| Index Of Refraction |
1.600 |
| In Vitro |
Corydaline (12.5-50 µM; 24 hours) treatment inhibits EV71 replication by suppressing the COX-2 expression and the phosphorylation of JNK MAPK and P38 MAPK but not ERK MAPK in vitro.
Corydaline could inhibit the viral RNA synthesis in a dose dependent manner. |
| In Vivo |
Corydaline (10 mg/kg; subcutaneous administration; once) treatment shows antinociceptive effects in mice by significantly inhibiting the writhing behavior. |
| PSA |
40.16000 |
| Target |
AChE; Enterovirus; Opioid Receptor |
| Vapor Pressure |
0.0±1.2 mmHg at 25°C |
| XLogP3-AA |
3.6 |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/518-69-4.gif)
