| Synonyms |
Desethylhydroxychloroquine oxalate; 2-[[4-[(7-Chloro-4-quinolinyl)amino]pentyl]amino]ethanol Oxalate; (+/-)-Desethylhydroxychloroquine Oxalate; 2-({4-[(7-Chloro-4-quinolinyl)amino]pentyl}amino)ethanol ethanedioate (1:1); Ethanol, 2-[[4-[(7-chloro-4-quinolinyl)amino]pentyl]amino]-, ethanedioate (1:1) (salt) |
| IUPAC Name |
2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid |
| Molecular Weight |
397.85 |
| Molecular Formula |
C18H24ClN3O5 |
| Canonical SMILES |
CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl.C(=O)(C(=O)O)O |
| InChI |
InChI=1S/C16H22ClN3O.C2H2O4/c1-12(3-2-7-18-9-10-21)20-15-6-8-19-16-11-13(17)4-5-14(15)16;3-1(4)2(5)6/h4-6,8,11-12,18,21H,2-3,7,9-10H2,1H3,(H,19,20);(H,3,4)(H,5,6) |
| InChIKey |
DTVGVTDECKJJJK-UHFFFAOYSA-N |
| Melting Point |
>115°C (dec.) |
| Purity |
≥95% |
| Solubility |
Soluble in DMSO (Slightly, Heated), Methanol (Slightly) |
| Appearance |
Pale Yellow to Yellow Solid |
| Application |
A metabolite of Hydroxychloroquine. |
| Storage |
Store at 2-8°C, sealed storage, away from moisture |
| Complexity |
364 |
| Exact Mass |
397.1404486 |
| In Vivo |
BALB/c mice were given intravenous hydroxychloroquine (5mg/kg) for blood and tissue examination to determine the content of critoquine (deethylhydroxychloroquine). The tissue blood concentration ratio (Kp) is greater than or equal to 1, indicating the accumulation of clitoquine in the tissue. The Kp ratios of klitoquine in different tissues were liver (114.3>), kidney (24.4> spleen (19.3>), lung (16.5), > heart (5.5). |
| PSA |
131.78000 |
| Target |
Influenza Virus; Parasite |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/14142-64-4.gif)
