| Synonyms |
Catalpinoside; (1aS,1bS,2S,5aR,6S,6aS)-1a,1b,2,5a,6,6a-Hexahydro-6-hydroxy-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl-b-D-glucopyranoside |
| IUPAC Name |
(2S,3R,4S,5S,6R)-2-[[(1S,2S,4S,5S,6R,10S)-5-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
362.33 |
| Molecular Formula |
C15H22O10 |
| Canonical SMILES |
C1=COC(C2C1C(C3C2(O3)CO)O)OC4C(C(C(C(O4)CO)O)O)O |
| InChI |
InChI=1S/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6-,7-,8+,9-,10+,11-,12+,13+,14+,15-/m1/s1 |
| InChIKey |
LHDWRKICQLTVDL-PZYDOOQISA-N |
| Boiling Point |
675.6±55.0 °C | Condition: Press: 760 Torr |
| Melting Point |
207 °C |
| Flash Point |
362.4±31.5 °C |
| Purity |
>98% |
| Density |
1.72 g/cm3 |
| Solubility |
Soluble in DMSO |
| Appearance |
Powder |
| Application |
neuroprotective; anti-inflammatory; anti-hepatitis |
| Shelf Life |
2 years |
| Storage |
Store in a cool and dry place and at 0 - 4°C for short term (days to weeks) or -107°C for long term (months to years). |
| Complexity |
542 |
| Exact Mass |
362.12129689 |
| Index Of Refraction |
1.679 |
| In Vitro |
Catalpol (0.1 μg/mL; for 3 days) can induce neuronal differentiation in PC12 cells through activation of the intracellular signal transduction pathway, and promote neurite length. |
| In Vivo |
Catalpol (25-100 mg/kg; intraperitoneal injection; once) treatment clearly reduces blood urea nitrogen, serum creatinine levels and the expression of KIM-1 in renal ischemia/reperfusion-injury (IRI) mice. Catalpol markedly reduces the expression of PI3K, Akt and eNOS levels, and suppresses the TNF-α, IL-1β, IL-6 and IL-10 activities. |
| PSA |
161.60000 |
| Target |
HBV |
| Vapor Pressure |
0.0±4.7 mmHg at 25°C |
| XLogP3-AA |
-3.2 |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/2415-24-9.gif)
