| Synonyms |
(+)-Aphidicolin; (3R,4R,4aR,6aS,8R,9R,11aS,11bS)-4,9-bis(hydroxymethyl)-4,11b-dimethyltetradecahydro-8,11a-methanocyclohepta[a]naphthalene-3,9-diol |
| IUPAC Name |
(1S,2S,5R,6R,7R,10S,12R,13R)-6,13-bis(hydroxymethyl)-2,6-dimethyltetracyclo[10.3.1.01,10.02,7]hexadecane-5,13-diol |
| Molecular Weight |
338.48 |
| Molecular Formula |
C20H34O4 |
| Canonical SMILES |
CC12CCC(C(C1CCC3C24CCC(C(C3)C4)(CO)O)(C)CO)O |
| InChI |
InChI=1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey |
NOFOAYPPHIUXJR-APNQCZIXSA-N |
| Boiling Point |
507.8°C at 760 mmHg |
| Melting Point |
225-233°C |
| Flash Point |
230.4±24.7 °C |
| Purity |
>98% |
| Density |
1.22 g/cm3 |
| Solubility |
Soluble in DMSO |
| Appearance |
White to Off-white Powder |
| Application |
A reversible inhibitor of eukaryotic nuclear DNA replication |
| Shelf Life |
As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly. |
| Storage |
Store at -20°C |
| Complexity |
524 |
| Exact Mass |
338.245697 |
| Index Of Refraction |
1.586 |
| In Vitro |
Aphidicolin resulted in cellular enlargement and extension of cellular processes before cell lysis occurred. |
| In Vivo |
Aphidicolin inhibited tumor growth significantly. |
| PSA |
80.92000 |
| Target |
DNA/RNA Synthesis; HSV; Apoptosis; Antibiotic; Orthopoxvirus |
| Vapor Pressure |
0.0±3.0 mmHg at 25°C |
| XLogP3-AA |
2.5 |
![{PARAM:[Name]}()](https://resource.bocsci.com/structure/38966-21-1.gif)
